C19H15Br2FN2O4 — CID 1005267
(5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 1005267) has the molecular formula C19H15Br2FN2O4 and a molecular weight of 514.15 g/mol. Its IUPAC name is (5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1005267 |
| Molecular Formula | C19H15Br2FN2O4 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | (5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(Cc3ccccc3F)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C19H15Br2FN2O4/c1-2-28-14-8-11(15(20)16(21)17(14)25)7-13-18(26)24(19(27)23-13)9-10-5-3-4-6-12(10)22/h3-8,25H,2,9H2,1H3,(H,23,27)/b13-7+ |
| InChIKey | FLYNQEFGXQNVIY-NTUHNPAUSA-N |
| XLogP | 4.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|