C19H16Br2N2O7 — CID 126404601
methyl 5-[[(4Z)-4-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404601) has the molecular formula C19H16Br2N2O7 and a molecular weight of 544.15 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404601 |
| Molecular Formula | C19H16Br2N2O7 |
| Molecular Weight | 544.15 g/mol |
| Exact Mass | 541.93 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C19H16Br2N2O7/c1-3-29-13-7-9(14(20)15(21)16(13)24)6-11-17(25)23(19(27)22-11)8-10-4-5-12(30-10)18(26)28-2/h4-7,24H,3,8H2,1-2H3,(H,22,27)/b11-6- |
| InChIKey | NLOJEORANVYRJK-WDZFZDKYSA-N |
| XLogP | 3.79 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|