C20H15Br2N3O7 — CID 126404845
methyl 5-[[(4Z)-4-[[2,3-dibromo-4-(cyanomethoxy)-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404845) has the molecular formula C20H15Br2N3O7 and a molecular weight of 569.16 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2,3-dibromo-4-(cyanomethoxy)-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2,3-dibromo-4-(cyanomethoxy)-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404845 |
| Molecular Formula | C20H15Br2N3O7 |
| Molecular Weight | 569.16 g/mol |
| Exact Mass | 566.93 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2,3-dibromo-4-(cyanomethoxy)-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(OC)c(OCC#N)c(Br)c3Br)C2=O)o1 |
| InChI | InChI=1S/C20H15Br2N3O7/c1-29-14-8-10(15(21)16(22)17(14)31-6-5-23)7-12-18(26)25(20(28)24-12)9-11-3-4-13(32-11)19(27)30-2/h3-4,7-8H,6,9H2,1-2H3,(H,24,28)/b12-7- |
| InChIKey | NZDKEAJLHUAQPM-GHXNOFRVSA-N |
| XLogP | 3.60 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|