C19H17BrN2O7 — CID 124551484
methyl 5-[[(4Z)-4-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 124551484) has the molecular formula C19H17BrN2O7 and a molecular weight of 465.26 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124551484 |
| Molecular Formula | C19H17BrN2O7 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)cc(OC)c3OC)C2=O)o1 |
| InChI | InChI=1S/C19H17BrN2O7/c1-26-15-8-11(20)6-10(16(15)27-2)7-13-17(23)22(19(25)21-13)9-12-4-5-14(29-12)18(24)28-3/h4-8H,9H2,1-3H3,(H,21,25)/b13-7- |
| InChIKey | ZLRDUBTVHVHACD-QPEQYQDCSA-N |
| XLogP | 2.94 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|