C21H19BrN2O9 — CID 126403585
(2S)-2-[4-bromo-2-methoxy-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 126403585) has the molecular formula C21H19BrN2O9 and a molecular weight of 523.29 g/mol. Its IUPAC name is (2S)-2-[4-bromo-2-methoxy-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-bromo-2-methoxy-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126403585 |
| Molecular Formula | C21H19BrN2O9 |
| Molecular Weight | 523.29 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | (2S)-2-[4-bromo-2-methoxy-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)cc(OC)c3O[C@@H](C)C(=O)O)C2=O)o1 |
| InChI | InChI=1S/C21H19BrN2O9/c1-10(19(26)27)32-17-11(6-12(22)8-16(17)30-2)7-14-18(25)24(21(29)23-14)9-13-4-5-15(33-13)20(28)31-3/h4-8,10H,9H2,1-3H3,(H,23,29)(H,26,27)/b14-7-/t10-/m0/s1 |
| InChIKey | FMSZNPIXPMBEGL-IXIHQHOXSA-N |
| XLogP | 2.78 |
| TPSA | 144.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|