C21H21BrN2O7 — CID 3720265
methyl 5-[[4-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 3720265) has the molecular formula C21H21BrN2O7 and a molecular weight of 493.31 g/mol. Its IUPAC name is methyl 5-[[4-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3720265 |
| Molecular Formula | C21H21BrN2O7 |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | methyl 5-[[4-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(OCC)c(C=C2NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc1Br |
| InChI | InChI=1S/C21H21BrN2O7/c1-4-29-17-10-18(30-5-2)14(22)8-12(17)9-15-19(25)24(21(27)23-15)11-13-6-7-16(31-13)20(26)28-3/h6-10H,4-5,11H2,1-3H3,(H,23,27) |
| InChIKey | YWHMGXHNXNZNDM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|