C19H16BrN3O7 — CID 6249787
methyl 5-[[(4Z)-4-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 6249787) has the molecular formula C19H16BrN3O7 and a molecular weight of 478.26 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6249787 |
| Molecular Formula | C19H16BrN3O7 |
| Molecular Weight | 478.26 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)ccc3OCC(N)=O)C2=O)o1 |
| InChI | InChI=1S/C19H16BrN3O7/c1-28-18(26)15-5-3-12(30-15)8-23-17(25)13(22-19(23)27)7-10-6-11(20)2-4-14(10)29-9-16(21)24/h2-7H,8-9H2,1H3,(H2,21,24)(H,22,27)/b13-7- |
| InChIKey | OPZPBHHDMAXJOQ-QPEQYQDCSA-N |
| XLogP | 1.79 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|