C26H23Br2N3O6 — CID 126403695
methyl 5-[[(4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126403695) has the molecular formula C26H23Br2N3O6 and a molecular weight of 633.29 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126403695 |
| Molecular Formula | C26H23Br2N3O6 |
| Molecular Weight | 633.29 g/mol |
| Exact Mass | 631.00 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-4-(dimethylamino)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(N(C)C)cc3OCc3ccc(Br)cc3Br)C2=O)o1 |
| InChI | InChI=1S/C26H23Br2N3O6/c1-30(2)18-7-5-15(23(12-18)36-14-16-4-6-17(27)11-20(16)28)10-21-24(32)31(26(34)29-21)13-19-8-9-22(37-19)25(33)35-3/h4-12H,13-14H2,1-3H3,(H,29,34)/b21-10- |
| InChIKey | IBKZSUDTRJGUDY-FBHDLOMBSA-N |
| XLogP | 5.33 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|