C23H25N3O8 — CID 124551192
methyl 5-[[(4Z)-4-[[4-(dimethylamino)-2-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 124551192) has the molecular formula C23H25N3O8 and a molecular weight of 471.47 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-(dimethylamino)-2-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-(dimethylamino)-2-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124551192 |
| Molecular Formula | C23H25N3O8 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-(dimethylamino)-2-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)COc1cc(N(C)C)ccc1/C=C1\NC(=O)N(Cc2ccc(C(=O)OC)o2)C1=O |
| InChI | InChI=1S/C23H25N3O8/c1-5-32-20(27)13-33-19-11-15(25(2)3)7-6-14(19)10-17-21(28)26(23(30)24-17)12-16-8-9-18(34-16)22(29)31-4/h6-11H,5,12-13H2,1-4H3,(H,24,30)/b17-10- |
| InChIKey | DWLFBPFJXRHZEJ-YVLHZVERSA-N |
| XLogP | 2.17 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|