C19H19N3O6 — CID 4311367
methyl 5-[[4-[[4-(dimethylamino)-2-hydroxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 4311367) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl 5-[[4-[[4-(dimethylamino)-2-hydroxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[4-(dimethylamino)-2-hydroxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4311367 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 5-[[4-[[4-(dimethylamino)-2-hydroxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3ccc(N(C)C)cc3O)C2=O)o1 |
| InChI | InChI=1S/C19H19N3O6/c1-21(2)12-5-4-11(15(23)9-12)8-14-17(24)22(19(26)20-14)10-13-6-7-16(28-13)18(25)27-3/h4-9,23H,10H2,1-3H3,(H,20,26) |
| InChIKey | UWTPYVUWOBLXLF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|