C18H14BrClN2O7 — CID 5145371
methyl 5-[[4-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 5145371) has the molecular formula C18H14BrClN2O7 and a molecular weight of 485.67 g/mol. Its IUPAC name is methyl 5-[[4-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5145371 |
| Molecular Formula | C18H14BrClN2O7 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | methyl 5-[[4-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3cc(OC)c(O)c(Cl)c3Br)C2=O)o1 |
| InChI | InChI=1S/C18H14BrClN2O7/c1-27-12-6-8(13(19)14(20)15(12)23)5-10-16(24)22(18(26)21-10)7-9-3-4-11(29-9)17(25)28-2/h3-6,23H,7H2,1-2H3,(H,21,26) |
| InChIKey | GIQAFSWACZGYDF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|