C17H13N3O8 — CID 6281480
methyl 5-[[(4Z)-4-[(2-hydroxy-5-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 6281480) has the molecular formula C17H13N3O8 and a molecular weight of 387.30 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(2-hydroxy-5-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(2-hydroxy-5-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6281480 |
| Molecular Formula | C17H13N3O8 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(2-hydroxy-5-nitrophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc([N+](=O)[O-])ccc3O)C2=O)o1 |
| InChI | InChI=1S/C17H13N3O8/c1-27-16(23)14-5-3-11(28-14)8-19-15(22)12(18-17(19)24)7-9-6-10(20(25)26)2-4-13(9)21/h2-7,21H,8H2,1H3,(H,18,24)/b12-7- |
| InChIKey | BWENEVOBRILFLJ-GHXNOFRVSA-N |
| XLogP | 1.77 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|