C21H19N3O10 — CID 124549307
methyl 5-[[(4Z)-4-[[2-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 124549307) has the molecular formula C21H19N3O10 and a molecular weight of 473.39 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124549307 |
| Molecular Formula | C21H19N3O10 |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cccc([N+](=O)[O-])c3O[C@@H](C)C(=O)OC)C2=O)o1 |
| InChI | InChI=1S/C21H19N3O10/c1-11(19(26)31-2)33-17-12(5-4-6-15(17)24(29)30)9-14-18(25)23(21(28)22-14)10-13-7-8-16(34-13)20(27)32-3/h4-9,11H,10H2,1-3H3,(H,22,28)/b14-9-/t11-/m0/s1 |
| InChIKey | QQKHQJFIZBWCTQ-HOXUKUGESA-N |
| XLogP | 2.01 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|