C26H22N4O9 — CID 126407628
methyl 5-[[(4Z)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126407628) has the molecular formula C26H22N4O9 and a molecular weight of 534.48 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126407628 |
| Molecular Formula | C26H22N4O9 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cccc([N+](=O)[O-])c3OCC(=O)Nc3ccc(C)cc3)C2=O)o1 |
| InChI | InChI=1S/C26H22N4O9/c1-15-6-8-17(9-7-15)27-22(31)14-38-23-16(4-3-5-20(23)30(35)36)12-19-24(32)29(26(34)28-19)13-18-10-11-21(39-18)25(33)37-2/h3-12H,13-14H2,1-2H3,(H,27,31)(H,28,34)/b19-12- |
| InChIKey | YVJDUGLFPMESGM-UNOMPAQXSA-N |
| XLogP | 3.39 |
| TPSA | 170.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|