C20H17N3O11 — CID 4303254
2-[2-methoxy-4-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-nitrophenoxy]acetic acid (PubChem CID 4303254) has the molecular formula C20H17N3O11 and a molecular weight of 475.37 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-nitrophenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 4303254 |
| Molecular Formula | C20H17N3O11 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 2-[2-methoxy-4-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-nitrophenoxy]acetic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3cc(OC)c(OCC(=O)O)c([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C20H17N3O11/c1-31-15-7-10(6-13(23(29)30)17(15)33-9-16(24)25)5-12-18(26)22(20(28)21-12)8-11-3-4-14(34-11)19(27)32-2/h3-7H,8-9H2,1-2H3,(H,21,28)(H,24,25) |
| InChIKey | WJCKCCOYCBSHFH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 187.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|