C26H22IN3O8 — CID 126405936
methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126405936) has the molecular formula C26H22IN3O8 and a molecular weight of 631.38 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126405936 |
| Molecular Formula | C26H22IN3O8 |
| Molecular Weight | 631.38 g/mol |
| Exact Mass | 631.05 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(I)c(OCC(=O)Nc4ccccc4)c(OC)c3)C2=O)o1 |
| InChI | InChI=1S/C26H22IN3O8/c1-35-21-12-15(10-18(27)23(21)37-14-22(31)28-16-6-4-3-5-7-16)11-19-24(32)30(26(34)29-19)13-17-8-9-20(38-17)25(33)36-2/h3-12H,13-14H2,1-2H3,(H,28,31)(H,29,34)/b19-11- |
| InChIKey | YDUOCGGHVBNHLF-ODLFYWEKSA-N |
| XLogP | 3.79 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|