C27H23Br2N3O8 — CID 126404547
methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-2,3-dibromo-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404547) has the molecular formula C27H23Br2N3O8 and a molecular weight of 677.30 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-2,3-dibromo-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-2,3-dibromo-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404547 |
| Molecular Formula | C27H23Br2N3O8 |
| Molecular Weight | 677.30 g/mol |
| Exact Mass | 674.99 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-2,3-dibromo-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)c(Br)c(Br)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H23Br2N3O8/c1-3-38-20-12-15(22(28)23(29)24(20)39-14-21(33)30-16-7-5-4-6-8-16)11-18-25(34)32(27(36)31-18)13-17-9-10-19(40-17)26(35)37-2/h4-12H,3,13-14H2,1-2H3,(H,30,33)(H,31,36)/b18-11- |
| InChIKey | MYXMJGDXGAZCPQ-WQRHYEAKSA-N |
| XLogP | 5.10 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|