C26H22N4O10 — CID 126402749
methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402749) has the molecular formula C26H22N4O10 and a molecular weight of 550.48 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402749 |
| Molecular Formula | C26H22N4O10 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-(2-anilino-2-oxoethoxy)-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(OC)c(OCC(=O)Nc4ccccc4)c([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C26H22N4O10/c1-37-21-12-15(11-19(30(35)36)23(21)39-14-22(31)27-16-6-4-3-5-7-16)10-18-24(32)29(26(34)28-18)13-17-8-9-20(40-17)25(33)38-2/h3-12H,13-14H2,1-2H3,(H,27,31)(H,28,34)/b18-10- |
| InChIKey | BWBKHJHDKLVREB-ZDLGFXPLSA-N |
| XLogP | 3.09 |
| TPSA | 179.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|