C28H25IN4O6 — CID 126107609
2-[(4E)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126107609) has the molecular formula C28H25IN4O6 and a molecular weight of 640.43 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126107609 |
| Molecular Formula | C28H25IN4O6 |
| Molecular Weight | 640.43 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | 2-[(4E)-4-[[4-(2-anilino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3cccc(C)c3)C2=O)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H25IN4O6/c1-17-7-6-10-20(11-17)31-24(34)15-33-27(36)22(32-28(33)37)13-18-12-21(29)26(23(14-18)38-2)39-16-25(35)30-19-8-4-3-5-9-19/h3-14H,15-16H2,1-2H3,(H,30,35)(H,31,34)(H,32,37)/b22-13+ |
| InChIKey | SKYUYVDYGNGXCB-LPYMAVHISA-N |
| XLogP | 4.16 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|