C30H29IN4O7 — CID 126236989
2-[(4E)-4-[[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126236989) has the molecular formula C30H29IN4O7 and a molecular weight of 684.49 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126236989 |
| Molecular Formula | C30H29IN4O7 |
| Molecular Weight | 684.49 g/mol |
| Exact Mass | 684.11 |
| IUPAC Name | 2-[(4E)-4-[[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)cc(I)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C30H29IN4O7/c1-4-41-25-15-19(13-21(31)28(25)42-17-27(37)32-20-11-9-18(2)10-12-20)14-23-29(38)35(30(39)34-23)16-26(36)33-22-7-5-6-8-24(22)40-3/h5-15H,4,16-17H2,1-3H3,(H,32,37)(H,33,36)(H,34,39)/b23-14+ |
| InChIKey | GSFNFJYRWNIUKM-OEAKJJBVSA-N |
| XLogP | 4.56 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|