C29H28IN3O5 — CID 126105207
2-[(4E)-4-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126105207) has the molecular formula C29H28IN3O5 and a molecular weight of 625.46 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126105207 |
| Molecular Formula | C29H28IN3O5 |
| Molecular Weight | 625.46 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | 2-[(4E)-4-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3cccc(C)c3)C2=O)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C29H28IN3O5/c1-4-37-25-15-21(13-23(30)27(25)38-17-20-10-8-18(2)9-11-20)14-24-28(35)33(29(36)32-24)16-26(34)31-22-7-5-6-19(3)12-22/h5-15H,4,16-17H2,1-3H3,(H,31,34)(H,32,36)/b24-14+ |
| InChIKey | MKBJASLZXILPCK-ZVHZXABRSA-N |
| XLogP | 5.42 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|