C28H24ClFN4O6 — CID 126021985
2-[(4E)-4-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126021985) has the molecular formula C28H24ClFN4O6 and a molecular weight of 566.97 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126021985 |
| Molecular Formula | C28H24ClFN4O6 |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 2-[(4E)-4-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H24ClFN4O6/c1-16-3-7-19(8-4-16)31-24(35)14-34-27(37)22(33-28(34)38)12-17-11-21(29)26(23(13-17)39-2)40-15-25(36)32-20-9-5-18(30)6-10-20/h3-13H,14-15H2,1-2H3,(H,31,35)(H,32,36)(H,33,38)/b22-12+ |
| InChIKey | MUSNGEXPXXRUIP-WSDLNYQXSA-N |
| XLogP | 4.35 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|