C23H24ClN3O5 — CID 21216102
2-[(4Z)-4-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 21216102) has the molecular formula C23H24ClN3O5 and a molecular weight of 457.91 g/mol. Its IUPAC name is 2-[(4Z)-4-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 21216102 |
| Molecular Formula | C23H24ClN3O5 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-[(4Z)-4-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\NC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C23H24ClN3O5/c1-13(2)32-21-17(24)9-15(11-19(21)31-4)10-18-22(29)27(23(30)26-18)12-20(28)25-16-7-5-14(3)6-8-16/h5-11,13H,12H2,1-4H3,(H,25,28)(H,26,30)/b18-10- |
| InChIKey | TVRQKLXAIZZTDZ-ZDLGFXPLSA-N |
| XLogP | 3.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|