C26H23IN2O7 — CID 126405113
methyl 5-[[(4Z)-4-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126405113) has the molecular formula C26H23IN2O7 and a molecular weight of 602.38 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126405113 |
| Molecular Formula | C26H23IN2O7 |
| Molecular Weight | 602.38 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(I)c(OCc4cccc(C)c4)c(OC)c3)C2=O)o1 |
| InChI | InChI=1S/C26H23IN2O7/c1-15-5-4-6-16(9-15)14-35-23-19(27)10-17(12-22(23)33-2)11-20-24(30)29(26(32)28-20)13-18-7-8-21(36-18)25(31)34-3/h4-12H,13-14H2,1-3H3,(H,28,32)/b20-11- |
| InChIKey | UIBNJUBOFHODLH-JAIQZWGSSA-N |
| XLogP | 4.66 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|