C24H18FN3O8 — CID 6178383
methyl 5-[[(4Z)-4-[[2-[(3-fluorophenyl)methoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 6178383) has the molecular formula C24H18FN3O8 and a molecular weight of 495.42 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-[(3-fluorophenyl)methoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-[(3-fluorophenyl)methoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6178383 |
| Molecular Formula | C24H18FN3O8 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-[(3-fluorophenyl)methoxy]-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cccc([N+](=O)[O-])c3OCc3cccc(F)c3)C2=O)o1 |
| InChI | InChI=1S/C24H18FN3O8/c1-34-23(30)20-9-8-17(36-20)12-27-22(29)18(26-24(27)31)11-15-5-3-7-19(28(32)33)21(15)35-13-14-4-2-6-16(25)10-14/h2-11H,12-13H2,1H3,(H,26,31)/b18-11- |
| InChIKey | XOTPVVVIQOYZGH-WQRHYEAKSA-N |
| XLogP | 3.79 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|