C28H21FN2O6 — CID 4241487
methyl 5-[[4-[[2-[(3-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 4241487) has the molecular formula C28H21FN2O6 and a molecular weight of 500.48 g/mol. Its IUPAC name is methyl 5-[[4-[[2-[(3-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[2-[(3-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4241487 |
| Molecular Formula | C28H21FN2O6 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | methyl 5-[[4-[[2-[(3-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3c(OCc4cccc(F)c4)ccc4ccccc34)C2=O)o1 |
| InChI | InChI=1S/C28H21FN2O6/c1-35-27(33)25-12-10-20(37-25)15-31-26(32)23(30-28(31)34)14-22-21-8-3-2-6-18(21)9-11-24(22)36-16-17-5-4-7-19(29)13-17/h2-14H,15-16H2,1H3,(H,30,34) |
| InChIKey | HHMGJNWZQXITBI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|