C24H18ClFN2O6 — CID 3948812
methyl 5-[[4-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 3948812) has the molecular formula C24H18ClFN2O6 and a molecular weight of 484.87 g/mol. Its IUPAC name is methyl 5-[[4-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3948812 |
| Molecular Formula | C24H18ClFN2O6 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | methyl 5-[[4-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3ccc(OCc4ccc(F)cc4)c(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C24H18ClFN2O6/c1-32-23(30)21-9-7-17(34-21)12-28-22(29)19(27-24(28)31)11-15-4-8-20(18(25)10-15)33-13-14-2-5-16(26)6-3-14/h2-11H,12-13H2,1H3,(H,27,31) |
| InChIKey | JCRUJPOQZMMPEZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|