C25H19ClFN3O7 — CID 126404537
methyl 5-[[(4Z)-4-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404537) has the molecular formula C25H19ClFN3O7 and a molecular weight of 527.89 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404537 |
| Molecular Formula | C25H19ClFN3O7 |
| Molecular Weight | 527.89 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(OCC(=O)Nc4ccccc4F)c(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C25H19ClFN3O7/c1-35-24(33)21-9-7-15(37-21)12-30-23(32)19(29-25(30)34)11-14-6-8-20(16(26)10-14)36-13-22(31)28-18-5-3-2-4-17(18)27/h2-11H,12-13H2,1H3,(H,28,31)(H,29,34)/b19-11- |
| InChIKey | MUBYBSAVDWYBPA-ODLFYWEKSA-N |
| XLogP | 3.97 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|