C30H26N4O8 — CID 126407594
methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126407594) has the molecular formula C30H26N4O8 and a molecular weight of 570.56 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126407594 |
| Molecular Formula | C30H26N4O8 |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(C)n(-c4ccc(OCc5ccc([N+](=O)[O-])cc5)cc4)c3C)C2=O)o1 |
| InChI | InChI=1S/C30H26N4O8/c1-18-14-21(15-26-28(35)32(30(37)31-26)16-25-12-13-27(42-25)29(36)40-3)19(2)33(18)22-8-10-24(11-9-22)41-17-20-4-6-23(7-5-20)34(38)39/h4-15H,16-17H2,1-3H3,(H,31,37)/b26-15- |
| InChIKey | YRWXXEHGFVEYLW-YSMPRRRNSA-N |
| XLogP | 5.05 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|