C30H25FN2O6S — CID 126391756
methyl 5-[[(5E)-5-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126391756) has the molecular formula C30H25FN2O6S and a molecular weight of 560.60 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126391756 |
| Molecular Formula | C30H25FN2O6S |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | methyl 5-[[(5E)-5-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3cc(C)n(-c4ccc(OCc5ccc(F)cc5)cc4)c3C)C2=O)o1 |
| InChI | InChI=1S/C30H25FN2O6S/c1-18-14-21(15-27-28(34)32(30(36)40-27)16-25-12-13-26(39-25)29(35)37-3)19(2)33(18)23-8-10-24(11-9-23)38-17-20-4-6-22(31)7-5-20/h4-15H,16-17H2,1-3H3/b27-15+ |
| InChIKey | URYVEJFOGGQORM-JFLMPSFJSA-N |
| XLogP | 6.43 |
| TPSA | 90.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|