C27H27N3O8 — CID 126402534
methyl 5-[[(4Z)-4-[[1-[4-[(2R)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402534) has the molecular formula C27H27N3O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[1-[4-[(2R)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[1-[4-[(2R)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402534 |
| Molecular Formula | C27H27N3O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[1-[4-[(2R)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(C)n(-c4ccc(O[C@H](C)C(=O)OC)cc4)c3C)C2=O)o1 |
| InChI | InChI=1S/C27H27N3O8/c1-15-12-18(16(2)30(15)19-6-8-20(9-7-19)37-17(3)25(32)35-4)13-22-24(31)29(27(34)28-22)14-21-10-11-23(38-21)26(33)36-5/h6-13,17H,14H2,1-5H3,(H,28,34)/b22-13-/t17-/m1/s1 |
| InChIKey | ARIRSOWHFWQQJZ-VYZAVGSRSA-N |
| XLogP | 3.51 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|