C24H22N4O8 — CID 3503706
methyl 5-[[4-[[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 3503706) has the molecular formula C24H22N4O8 and a molecular weight of 494.46 g/mol. Its IUPAC name is methyl 5-[[4-[[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3503706 |
| Molecular Formula | C24H22N4O8 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | methyl 5-[[4-[[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3cc(C)n(-c4cc([N+](=O)[O-])ccc4OC)c3C)C2=O)o1 |
| InChI | InChI=1S/C24H22N4O8/c1-13-9-15(14(2)27(13)19-11-16(28(32)33)5-7-20(19)34-3)10-18-22(29)26(24(31)25-18)12-17-6-8-21(36-17)23(30)35-4/h5-11H,12H2,1-4H3,(H,25,31) |
| InChIKey | FCRSVCMTCZMCHI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|