C24H16Br4N2O6 — CID 126404818
methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404818) has the molecular formula C24H16Br4N2O6 and a molecular weight of 748.02 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404818 |
| Molecular Formula | C24H16Br4N2O6 |
| Molecular Weight | 748.02 g/mol |
| Exact Mass | 743.77 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)c(OCc4ccc(Br)cc4Br)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C24H16Br4N2O6/c1-34-23(32)20-5-4-15(36-20)10-30-22(31)19(29-24(30)33)8-12-6-17(27)21(18(28)7-12)35-11-13-2-3-14(25)9-16(13)26/h2-9H,10-11H2,1H3,(H,29,33)/b19-8- |
| InChIKey | NNNIUBRGUCROQT-UWVJOHFNSA-N |
| XLogP | 6.79 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.02 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|