C26H21BrCl2N2O7 — CID 126405081
methyl 5-[[(4Z)-4-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126405081) has the molecular formula C26H21BrCl2N2O7 and a molecular weight of 624.27 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126405081 |
| Molecular Formula | C26H21BrCl2N2O7 |
| Molecular Weight | 624.27 g/mol |
| Exact Mass | 621.99 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H21BrCl2N2O7/c1-3-36-22-11-15(8-17(27)23(22)37-13-14-4-6-18(28)19(29)9-14)10-20-24(32)31(26(34)30-20)12-16-5-7-21(38-16)25(33)35-2/h4-11H,3,12-13H2,1-2H3,(H,30,34)/b20-10- |
| InChIKey | SVXWLWRUQNCADK-JMIUGGIZSA-N |
| XLogP | 6.21 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.27 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|