C25H19BrN2O7 — CID 126414777
methyl 5-[[(4E)-4-[[5-bromo-2-(4-methylbenzoyl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126414777) has the molecular formula C25H19BrN2O7 and a molecular weight of 539.34 g/mol. Its IUPAC name is methyl 5-[[(4E)-4-[[5-bromo-2-(4-methylbenzoyl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4E)-4-[[5-bromo-2-(4-methylbenzoyl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126414777 |
| Molecular Formula | C25H19BrN2O7 |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | methyl 5-[[(4E)-4-[[5-bromo-2-(4-methylbenzoyl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C/c3cc(Br)ccc3OC(=O)c3ccc(C)cc3)C2=O)o1 |
| InChI | InChI=1S/C25H19BrN2O7/c1-14-3-5-15(6-4-14)23(30)35-20-9-7-17(26)11-16(20)12-19-22(29)28(25(32)27-19)13-18-8-10-21(34-18)24(31)33-2/h3-12H,13H2,1-2H3,(H,27,32)/b19-12+ |
| InChIKey | XCUNEWLCLQTYOR-XDHOZWIPSA-N |
| XLogP | 4.45 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|