C20H17N3O7 — CID 124550112
methyl 5-[[(4Z)-4-[[2-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 124550112) has the molecular formula C20H17N3O7 and a molecular weight of 411.37 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124550112 |
| Molecular Formula | C20H17N3O7 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cccc(OC)c3OCC#N)C2=O)o1 |
| InChI | InChI=1S/C20H17N3O7/c1-27-15-5-3-4-12(17(15)29-9-8-21)10-14-18(24)23(20(26)22-14)11-13-6-7-16(30-13)19(25)28-2/h3-7,10H,9,11H2,1-2H3,(H,22,26)/b14-10- |
| InChIKey | ULRVQNUGNJNRCI-UVTDQMKNSA-N |
| XLogP | 2.07 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|