C24H22BrClN4O6 — CID 126379649
2-[(4Z)-4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 126379649) has the molecular formula C24H22BrClN4O6 and a molecular weight of 577.82 g/mol. Its IUPAC name is 2-[(4Z)-4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126379649 |
| Molecular Formula | C24H22BrClN4O6 |
| Molecular Weight | 577.82 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 2-[(4Z)-4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C\c2ccc(OCC(=O)N3CCOCC3)c(Br)c2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22BrClN4O6/c25-18-11-15(1-6-20(18)36-14-22(32)29-7-9-35-10-8-29)12-19-23(33)30(24(34)28-19)13-21(31)27-17-4-2-16(26)3-5-17/h1-6,11-12H,7-10,13-14H2,(H,27,31)(H,28,34)/b19-12- |
| InChIKey | DVODVEAICUKDEY-UNOMPAQXSA-N |
| XLogP | 2.87 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|