C23H20BrCl2N3O5 — CID 126374591
(5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126374591) has the molecular formula C23H20BrCl2N3O5 and a molecular weight of 569.24 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126374591 |
| Molecular Formula | C23H20BrCl2N3O5 |
| Molecular Weight | 569.24 g/mol |
| Exact Mass | 567.00 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C(COc1ccc(/C=C2\NC(=O)N(Cc3ccc(Cl)c(Cl)c3)C2=O)cc1Br)N1CCOCC1 |
| InChI | InChI=1S/C23H20BrCl2N3O5/c24-16-9-14(2-4-20(16)34-13-21(30)28-5-7-33-8-6-28)11-19-22(31)29(23(32)27-19)12-15-1-3-17(25)18(26)10-15/h1-4,9-11H,5-8,12-13H2,(H,27,32)/b19-11- |
| InChIKey | IDPFHQSPUDAHKT-ODLFYWEKSA-N |
| XLogP | 4.09 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|