C24H24N4O6 — CID 126235840
2-[(4Z)-4-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 126235840) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-[(4Z)-4-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4Z)-4-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 126235840 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-[(4Z)-4-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)N/C(=C\c2ccc(OCC(=O)N3CCOCC3)cc2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H24N4O6/c29-21(25-18-4-2-1-3-5-18)15-28-23(31)20(26-24(28)32)14-17-6-8-19(9-7-17)34-16-22(30)27-10-12-33-13-11-27/h1-9,14H,10-13,15-16H2,(H,25,29)(H,26,32)/b20-14- |
| InChIKey | SGNZKCXVFYFURL-ZHZULCJRSA-N |
| XLogP | 1.46 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|