C11H14F2N2O4S — CID 82914648
4-(2,3-difluoro-4-sulfamoylphenoxy)-N-methylbutanamide (PubChem CID 82914648) has the molecular formula C11H14F2N2O4S and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-sulfamoylphenoxy)-N-methylbutanamide.
| Compound Name | 4-(2,3-difluoro-4-sulfamoylphenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 82914648 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-(2,3-difluoro-4-sulfamoylphenoxy)-N-methylbutanamide |
| SMILES | CNC(=O)CCCOc1ccc(S(N)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C11H14F2N2O4S/c1-15-9(16)3-2-6-19-7-4-5-8(20(14,17)18)11(13)10(7)12/h4-5H,2-3,6H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | TYCNHEGFQWZEMT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|