C9H10Cl2N2O4S — CID 82911048
2-(2,3-dichloro-4-sulfamoylphenoxy)-N-methylacetamide (PubChem CID 82911048) has the molecular formula C9H10Cl2N2O4S and a molecular weight of 313.16 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-sulfamoylphenoxy)-N-methylacetamide.
| Compound Name | 2-(2,3-dichloro-4-sulfamoylphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 82911048 |
| Molecular Formula | C9H10Cl2N2O4S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 2-(2,3-dichloro-4-sulfamoylphenoxy)-N-methylacetamide |
| SMILES | CNC(=O)COc1ccc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O4S/c1-13-7(14)4-17-5-2-3-6(18(12,15)16)9(11)8(5)10/h2-3H,4H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | IQDYHDATNDEARQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |