C10H12F2N2O4S — CID 82914724
2-(2,3-difluoro-4-sulfamoylphenoxy)-N-ethylacetamide (PubChem CID 82914724) has the molecular formula C10H12F2N2O4S and a molecular weight of 294.28 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-sulfamoylphenoxy)-N-ethylacetamide.
| Compound Name | 2-(2,3-difluoro-4-sulfamoylphenoxy)-N-ethylacetamide |
|---|---|
| PubChem CID | 82914724 |
| Molecular Formula | C10H12F2N2O4S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-(2,3-difluoro-4-sulfamoylphenoxy)-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(S(N)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C10H12F2N2O4S/c1-2-14-8(15)5-18-6-3-4-7(19(13,16)17)10(12)9(6)11/h3-4H,2,5H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | SAAWHKOQIWGYGT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |