C10H12Cl2N2O4S — CID 82913877
2-(2,5-dichloro-4-sulfamoylphenoxy)-N-ethylacetamide (PubChem CID 82913877) has the molecular formula C10H12Cl2N2O4S and a molecular weight of 327.19 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-sulfamoylphenoxy)-N-ethylacetamide.
| Compound Name | 2-(2,5-dichloro-4-sulfamoylphenoxy)-N-ethylacetamide |
|---|---|
| PubChem CID | 82913877 |
| Molecular Formula | C10H12Cl2N2O4S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 2-(2,5-dichloro-4-sulfamoylphenoxy)-N-ethylacetamide |
| SMILES | CCNC(=O)COc1cc(Cl)c(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O4S/c1-2-14-10(15)5-18-8-3-7(12)9(4-6(8)11)19(13,16)17/h3-4H,2,5H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | RGHYFKBMOCGKSF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |