C9H9Cl2NO5S — CID 43164622
3-(2,5-dichloro-4-sulfamoylphenoxy)propanoic acid (PubChem CID 43164622) has the molecular formula C9H9Cl2NO5S and a molecular weight of 314.15 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-sulfamoylphenoxy)propanoic acid.
| Compound Name | 3-(2,5-dichloro-4-sulfamoylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 43164622 |
| Molecular Formula | C9H9Cl2NO5S |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 3-(2,5-dichloro-4-sulfamoylphenoxy)propanoic acid |
| SMILES | NS(=O)(=O)c1cc(Cl)c(OCCC(=O)O)cc1Cl |
| InChI | InChI=1S/C9H9Cl2NO5S/c10-5-4-8(18(12,15)16)6(11)3-7(5)17-2-1-9(13)14/h3-4H,1-2H2,(H,13,14)(H2,12,15,16) |
| InChIKey | ZWFZYYYDJDUQGG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |