C13H10Cl3NO3S — CID 43342568
2,5-dichloro-4-[(2-chlorophenyl)methoxy]benzenesulfonamide (PubChem CID 43342568) has the molecular formula C13H10Cl3NO3S and a molecular weight of 366.65 g/mol. Its IUPAC name is 2,5-dichloro-4-[(2-chlorophenyl)methoxy]benzenesulfonamide.
| Compound Name | 2,5-dichloro-4-[(2-chlorophenyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 43342568 |
| Molecular Formula | C13H10Cl3NO3S |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 2,5-dichloro-4-[(2-chlorophenyl)methoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(OCc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO3S/c14-9-4-2-1-3-8(9)7-20-12-5-11(16)13(6-10(12)15)21(17,18)19/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | GLHIAYRLLSPFLS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |