C12H13Cl2N3O3S — CID 82912915
2,5-dichloro-4-[(1-ethylimidazol-2-yl)methoxy]benzenesulfonamide (PubChem CID 82912915) has the molecular formula C12H13Cl2N3O3S and a molecular weight of 350.23 g/mol. Its IUPAC name is 2,5-dichloro-4-[(1-ethylimidazol-2-yl)methoxy]benzenesulfonamide.
| Compound Name | 2,5-dichloro-4-[(1-ethylimidazol-2-yl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82912915 |
| Molecular Formula | C12H13Cl2N3O3S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2,5-dichloro-4-[(1-ethylimidazol-2-yl)methoxy]benzenesulfonamide |
| SMILES | CCn1ccnc1COc1cc(Cl)c(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O3S/c1-2-17-4-3-16-12(17)7-20-10-5-9(14)11(6-8(10)13)21(15,18)19/h3-6H,2,7H2,1H3,(H2,15,18,19) |
| InChIKey | AWXPJKUNNKHKBE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |