C11H11Cl2NO3S — CID 104808576
2,5-dichloro-4-pent-3-ynoxybenzenesulfonamide (PubChem CID 104808576) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 2,5-dichloro-4-pent-3-ynoxybenzenesulfonamide.
| Compound Name | 2,5-dichloro-4-pent-3-ynoxybenzenesulfonamide |
|---|---|
| PubChem CID | 104808576 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2,5-dichloro-4-pent-3-ynoxybenzenesulfonamide |
| SMILES | CC#CCCOc1cc(Cl)c(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3S/c1-2-3-4-5-17-10-6-9(13)11(7-8(10)12)18(14,15)16/h6-7H,4-5H2,1H3,(H2,14,15,16) |
| InChIKey | BIYIHQOQUZOIKM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|