C9H12ClNO4S — CID 23285648
5-chloro-2-ethoxy-4-methoxybenzenesulfonamide (PubChem CID 23285648) has the molecular formula C9H12ClNO4S and a molecular weight of 265.72 g/mol. Its IUPAC name is 5-chloro-2-ethoxy-4-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-2-ethoxy-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23285648 |
| Molecular Formula | C9H12ClNO4S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 5-chloro-2-ethoxy-4-methoxybenzenesulfonamide |
| SMILES | CCOc1cc(OC)c(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H12ClNO4S/c1-3-15-8-5-7(14-2)6(10)4-9(8)16(11,12)13/h4-5H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | LKBYNWLGGUXABR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |