C13H19Cl2NO3S — CID 935451
2,5-dichloro-4-methoxy-N,N-dipropylbenzenesulfonamide (PubChem CID 935451) has the molecular formula C13H19Cl2NO3S and a molecular weight of 340.27 g/mol. Its IUPAC name is 2,5-dichloro-4-methoxy-N,N-dipropylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-4-methoxy-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 935451 |
| Molecular Formula | C13H19Cl2NO3S |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2,5-dichloro-4-methoxy-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cc(Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO3S/c1-4-6-16(7-5-2)20(17,18)13-9-10(14)12(19-3)8-11(13)15/h8-9H,4-7H2,1-3H3 |
| InChIKey | PWGWBFOBKNESJB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |