C11H14Cl2N2O4S — CID 82914905
2-(2,5-dichloro-4-sulfamoylphenoxy)-N,N-dimethylpropanamide (PubChem CID 82914905) has the molecular formula C11H14Cl2N2O4S and a molecular weight of 341.22 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-sulfamoylphenoxy)-N,N-dimethylpropanamide.
| Compound Name | 2-(2,5-dichloro-4-sulfamoylphenoxy)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 82914905 |
| Molecular Formula | C11H14Cl2N2O4S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-(2,5-dichloro-4-sulfamoylphenoxy)-N,N-dimethylpropanamide |
| SMILES | CC(Oc1cc(Cl)c(S(N)(=O)=O)cc1Cl)C(=O)N(C)C |
| InChI | InChI=1S/C11H14Cl2N2O4S/c1-6(11(16)15(2)3)19-9-4-8(13)10(5-7(9)12)20(14,17)18/h4-6H,1-3H3,(H2,14,17,18) |
| InChIKey | MZXZYFFFXLEOJM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |